C9H18N2O5S — CID 62933176
3,3-dimethyl-5-oxo-5-(2-sulfamoylethylamino)pentanoic acid (PubChem CID 62933176) has the molecular formula C9H18N2O5S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3,3-dimethyl-5-oxo-5-(2-sulfamoylethylamino)pentanoic acid.
| Compound Name | 3,3-dimethyl-5-oxo-5-(2-sulfamoylethylamino)pentanoic acid |
|---|---|
| PubChem CID | 62933176 |
| Molecular Formula | C9H18N2O5S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3,3-dimethyl-5-oxo-5-(2-sulfamoylethylamino)pentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C9H18N2O5S/c1-9(2,6-8(13)14)5-7(12)11-3-4-17(10,15)16/h3-6H2,1-2H3,(H,11,12)(H,13,14)(H2,10,15,16) |
| InChIKey | ZFMQGDXJVYTJGU-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |