C10H16N2O3 — CID 62933016
5-(2-cyanoethylamino)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 62933016) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-(2-cyanoethylamino)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(2-cyanoethylamino)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62933016 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 5-(2-cyanoethylamino)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(=O)NCCC#N |
| InChI | InChI=1S/C10H16N2O3/c1-10(2,7-9(14)15)6-8(13)12-5-3-4-11/h3,5-7H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | YHUAUVHFURGYPS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|