C8H13N3O3 — CID 43442289
2-[[2-(2-cyanoethylamino)-2-oxoethyl]-methylamino]acetic acid (PubChem CID 43442289) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-[[2-(2-cyanoethylamino)-2-oxoethyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-(2-cyanoethylamino)-2-oxoethyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 43442289 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-[[2-(2-cyanoethylamino)-2-oxoethyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC(=O)NCCC#N |
| InChI | InChI=1S/C8H13N3O3/c1-11(6-8(13)14)5-7(12)10-4-2-3-9/h2,4-6H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | UYNLFTLYPQGSJI-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|