C7H10N2O5S — CID 24707186
2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfonylacetic acid (PubChem CID 24707186) has the molecular formula C7H10N2O5S and a molecular weight of 234.23 g/mol. Its IUPAC name is 2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfonylacetic acid.
| Compound Name | 2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfonylacetic acid |
|---|---|
| PubChem CID | 24707186 |
| Molecular Formula | C7H10N2O5S |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-[2-(2-cyanoethylamino)-2-oxoethyl]sulfonylacetic acid |
| SMILES | N#CCCNC(=O)CS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C7H10N2O5S/c8-2-1-3-9-6(10)4-15(13,14)5-7(11)12/h1,3-5H2,(H,9,10)(H,11,12) |
| InChIKey | ZGSDEIUKCWTHTK-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|