C8H15N3O3S — CID 81190030
2-(2-aminopropylsulfonyl)-N-(2-cyanoethyl)acetamide (PubChem CID 81190030) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-(2-aminopropylsulfonyl)-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-(2-aminopropylsulfonyl)-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 81190030 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-(2-aminopropylsulfonyl)-N-(2-cyanoethyl)acetamide |
| SMILES | CC(N)CS(=O)(=O)CC(=O)NCCC#N |
| InChI | InChI=1S/C8H15N3O3S/c1-7(10)5-15(13,14)6-8(12)11-4-2-3-9/h7H,2,4-6,10H2,1H3,(H,11,12) |
| InChIKey | FNHAPGUWVNHCLO-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|