C9H17N3O — CID 43364126
2-amino-N-(2-cyanoethyl)-4-methylpentanamide (PubChem CID 43364126) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-amino-N-(2-cyanoethyl)-4-methylpentanamide.
| Compound Name | 2-amino-N-(2-cyanoethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 43364126 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2-amino-N-(2-cyanoethyl)-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)NCCC#N |
| InChI | InChI=1S/C9H17N3O/c1-7(2)6-8(11)9(13)12-5-3-4-10/h7-8H,3,5-6,11H2,1-2H3,(H,12,13) |
| InChIKey | RRLWXHKFYDIJDR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|