C9H17F3N2O — CID 104903471
(2R)-2-amino-4-methyl-N-(3,3,3-trifluoropropyl)pentanamide (PubChem CID 104903471) has the molecular formula C9H17F3N2O and a molecular weight of 226.24 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-N-(3,3,3-trifluoropropyl)pentanamide.
| Compound Name | (2R)-2-amino-4-methyl-N-(3,3,3-trifluoropropyl)pentanamide |
|---|---|
| PubChem CID | 104903471 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (2R)-2-amino-4-methyl-N-(3,3,3-trifluoropropyl)pentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O/c1-6(2)5-7(13)8(15)14-4-3-9(10,11)12/h6-7H,3-5,13H2,1-2H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | KACGCDNIASFXEI-SSDOTTSWSA-N |
| XLogP | 1.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |