C8H15F3N2O2 — CID 104903880
(2R)-2-amino-4-methyl-N-(2,2,2-trifluoroethoxy)pentanamide (PubChem CID 104903880) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-N-(2,2,2-trifluoroethoxy)pentanamide.
| Compound Name | (2R)-2-amino-4-methyl-N-(2,2,2-trifluoroethoxy)pentanamide |
|---|---|
| PubChem CID | 104903880 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2R)-2-amino-4-methyl-N-(2,2,2-trifluoroethoxy)pentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-5(2)3-6(12)7(14)13-15-4-8(9,10)11/h5-6H,3-4,12H2,1-2H3,(H,13,14)/t6-/m1/s1 |
| InChIKey | NAYWBDMEUDSEHE-ZCFIWIBFSA-N |
| XLogP | 0.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|