C11H22N4O — CID 62640317
N-(2-cyanoethyl)-2-[2-[methyl(propan-2-yl)amino]ethylamino]acetamide (PubChem CID 62640317) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[2-[methyl(propan-2-yl)amino]ethylamino]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[2-[methyl(propan-2-yl)amino]ethylamino]acetamide |
|---|---|
| PubChem CID | 62640317 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | N-(2-cyanoethyl)-2-[2-[methyl(propan-2-yl)amino]ethylamino]acetamide |
| SMILES | CC(C)N(C)CCNCC(=O)NCCC#N |
| InChI | InChI=1S/C11H22N4O/c1-10(2)15(3)8-7-13-9-11(16)14-6-4-5-12/h10,13H,4,6-9H2,1-3H3,(H,14,16) |
| InChIKey | SWYSQSVROMOLSN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|