C12H29N3O — CID 170647127
N,N-dimethyl-2-[2-[methyl(propan-2-yl)amino]ethylamino]acetamide;ethane (PubChem CID 170647127) has the molecular formula C12H29N3O and a molecular weight of 231.38 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-[methyl(propan-2-yl)amino]ethylamino]acetamide;ethane.
| Compound Name | N,N-dimethyl-2-[2-[methyl(propan-2-yl)amino]ethylamino]acetamide;ethane |
|---|---|
| PubChem CID | 170647127 |
| Molecular Formula | C12H29N3O |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.23 |
| IUPAC Name | N,N-dimethyl-2-[2-[methyl(propan-2-yl)amino]ethylamino]acetamide;ethane |
| SMILES | CC.CC(C)N(C)CCNCC(=O)N(C)C |
| InChI | InChI=1S/C10H23N3O.C2H6/c1-9(2)13(5)7-6-11-8-10(14)12(3)4;1-2/h9,11H,6-8H2,1-5H3;1-2H3 |
| InChIKey | GTJYYXWFXMWNRA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|