C10H20N2O2 — CID 114467467
N,N-dimethyl-2-[2-(2-methylprop-2-enoxy)ethylamino]acetamide (PubChem CID 114467467) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(2-methylprop-2-enoxy)ethylamino]acetamide.
| Compound Name | N,N-dimethyl-2-[2-(2-methylprop-2-enoxy)ethylamino]acetamide |
|---|---|
| PubChem CID | 114467467 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N,N-dimethyl-2-[2-(2-methylprop-2-enoxy)ethylamino]acetamide |
| SMILES | C=C(C)COCCNCC(=O)N(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-9(2)8-14-6-5-11-7-10(13)12(3)4/h11H,1,5-8H2,2-4H3 |
| InChIKey | VQZQTNRQCHPDAF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|