C8H16N2O — CID 60698028
N,N-dimethyl-2-(2-methylprop-2-enylamino)acetamide (PubChem CID 60698028) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-methylprop-2-enylamino)acetamide.
| Compound Name | N,N-dimethyl-2-(2-methylprop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 60698028 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | N,N-dimethyl-2-(2-methylprop-2-enylamino)acetamide |
| SMILES | C=C(C)CNCC(=O)N(C)C |
| InChI | InChI=1S/C8H16N2O/c1-7(2)5-9-6-8(11)10(3)4/h9H,1,5-6H2,2-4H3 |
| InChIKey | WVFZADDNIADJJI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|