C11H24N2O — CID 43214901
2-(heptylamino)-N,N-dimethylacetamide (PubChem CID 43214901) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-(heptylamino)-N,N-dimethylacetamide.
| Compound Name | 2-(heptylamino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43214901 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-(heptylamino)-N,N-dimethylacetamide |
| SMILES | CCCCCCCNCC(=O)N(C)C |
| InChI | InChI=1S/C11H24N2O/c1-4-5-6-7-8-9-12-10-11(14)13(2)3/h12H,4-10H2,1-3H3 |
| InChIKey | SFCLNVWBXPLXCW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|