C10H20CuNO2 — CID 21278666
copper(1+);2-(octylamino)acetate (PubChem CID 21278666) has the molecular formula C10H20CuNO2 and a molecular weight of 249.82 g/mol. Its IUPAC name is copper(1+);2-(octylamino)acetate.
| Compound Name | copper(1+);2-(octylamino)acetate |
|---|---|
| PubChem CID | 21278666 |
| Molecular Formula | C10H20CuNO2 |
| Molecular Weight | 249.82 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | copper(1+);2-(octylamino)acetate |
| SMILES | CCCCCCCCNCC(=O)[O-].[Cu+] |
| InChI | InChI=1S/C10H21NO2.Cu/c1-2-3-4-5-6-7-8-11-9-10(12)13;/h11H,2-9H2,1H3,(H,12,13);/q;+1/p-1 |
| InChIKey | YKAGSDQARQYNPS-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.82 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|