C17H37N3O — CID 83113481
3-[2-(dodecylamino)ethyl]-1,1-dimethylurea (PubChem CID 83113481) has the molecular formula C17H37N3O and a molecular weight of 299.50 g/mol. Its IUPAC name is 3-[2-(dodecylamino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(dodecylamino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83113481 |
| Molecular Formula | C17H37N3O |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.29 |
| IUPAC Name | 3-[2-(dodecylamino)ethyl]-1,1-dimethylurea |
| SMILES | CCCCCCCCCCCCNCCNC(=O)N(C)C |
| InChI | InChI=1S/C17H37N3O/c1-4-5-6-7-8-9-10-11-12-13-14-18-15-16-19-17(21)20(2)3/h18H,4-16H2,1-3H3,(H,19,21) |
| InChIKey | VGMMELRVKJXFGB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|