C15H32N2O — CID 157310048
2,2-dimethyl-N-[2-(octylamino)ethyl]propanamide (PubChem CID 157310048) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-(octylamino)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-(octylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 157310048 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 2,2-dimethyl-N-[2-(octylamino)ethyl]propanamide |
| SMILES | CCCCCCCCNCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H32N2O/c1-5-6-7-8-9-10-11-16-12-13-17-14(18)15(2,3)4/h16H,5-13H2,1-4H3,(H,17,18) |
| InChIKey | GSJYWOXVAFXHSW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|