C8H18N2O2 — CID 107302711
3-(5-hydroxypentyl)-1,1-dimethylurea (PubChem CID 107302711) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-(5-hydroxypentyl)-1,1-dimethylurea.
| Compound Name | 3-(5-hydroxypentyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 107302711 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-(5-hydroxypentyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCCCCO |
| InChI | InChI=1S/C8H18N2O2/c1-10(2)8(12)9-6-4-3-5-7-11/h11H,3-7H2,1-2H3,(H,9,12) |
| InChIKey | MRXXYVRKOXRXIE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|