C10H20N4O — CID 83121561
3-[2-(4-cyanobutylamino)ethyl]-1,1-dimethylurea (PubChem CID 83121561) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 3-[2-(4-cyanobutylamino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(4-cyanobutylamino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83121561 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 3-[2-(4-cyanobutylamino)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCCCCC#N |
| InChI | InChI=1S/C10H20N4O/c1-14(2)10(15)13-9-8-12-7-5-3-4-6-11/h12H,3-5,7-9H2,1-2H3,(H,13,15) |
| InChIKey | SAQAKAHTJKPHGW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|