C8H19N3O3 — CID 83120613
3-[2-[[(2S)-2,3-dihydroxypropyl]amino]ethyl]-1,1-dimethylurea (PubChem CID 83120613) has the molecular formula C8H19N3O3 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-[2-[[(2S)-2,3-dihydroxypropyl]amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[(2S)-2,3-dihydroxypropyl]amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83120613 |
| Molecular Formula | C8H19N3O3 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | 3-[2-[[(2S)-2,3-dihydroxypropyl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNC[C@H](O)CO |
| InChI | InChI=1S/C8H19N3O3/c1-11(2)8(14)10-4-3-9-5-7(13)6-12/h7,9,12-13H,3-6H2,1-2H3,(H,10,14)/t7-/m0/s1 |
| InChIKey | WWAWDVSMWLZTCT-ZETCQYMHSA-N |
| XLogP | -1.80 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|