C14H22FN3O3 — CID 83113487
3-[2-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]-1,1-dimethylurea (PubChem CID 83113487) has the molecular formula C14H22FN3O3 and a molecular weight of 299.35 g/mol. Its IUPAC name is 3-[2-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83113487 |
| Molecular Formula | C14H22FN3O3 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3-[2-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C14H22FN3O3/c1-18(2)14(20)17-8-7-16-9-12(19)10-21-13-5-3-11(15)4-6-13/h3-6,12,16,19H,7-10H2,1-2H3,(H,17,20) |
| InChIKey | TUQPYUMUKQISMJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|