C14H19F4NO2 — CID 115519141
1-(4-fluorophenoxy)-3-(5,5,5-trifluoropentylamino)propan-2-ol (PubChem CID 115519141) has the molecular formula C14H19F4NO2 and a molecular weight of 309.30 g/mol. Its IUPAC name is 1-(4-fluorophenoxy)-3-(5,5,5-trifluoropentylamino)propan-2-ol.
| Compound Name | 1-(4-fluorophenoxy)-3-(5,5,5-trifluoropentylamino)propan-2-ol |
|---|---|
| PubChem CID | 115519141 |
| Molecular Formula | C14H19F4NO2 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-(4-fluorophenoxy)-3-(5,5,5-trifluoropentylamino)propan-2-ol |
| SMILES | OC(CNCCCCC(F)(F)F)COc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19F4NO2/c15-11-3-5-13(6-4-11)21-10-12(20)9-19-8-2-1-7-14(16,17)18/h3-6,12,19-20H,1-2,7-10H2 |
| InChIKey | USLGSRMHTFDRGK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|