C13H18F3NO3 — CID 63227399
1-(4-methoxyphenoxy)-3-(3,3,3-trifluoropropylamino)propan-2-ol (PubChem CID 63227399) has the molecular formula C13H18F3NO3 and a molecular weight of 293.28 g/mol. Its IUPAC name is 1-(4-methoxyphenoxy)-3-(3,3,3-trifluoropropylamino)propan-2-ol.
| Compound Name | 1-(4-methoxyphenoxy)-3-(3,3,3-trifluoropropylamino)propan-2-ol |
|---|---|
| PubChem CID | 63227399 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(4-methoxyphenoxy)-3-(3,3,3-trifluoropropylamino)propan-2-ol |
| SMILES | COc1ccc(OCC(O)CNCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO3/c1-19-11-2-4-12(5-3-11)20-9-10(18)8-17-7-6-13(14,15)16/h2-5,10,17-18H,6-9H2,1H3 |
| InChIKey | UJERGOZTKAEENX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|