C12H14F5NO2 — CID 106292239
1-(4-fluorophenoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol (PubChem CID 106292239) has the molecular formula C12H14F5NO2 and a molecular weight of 299.24 g/mol. Its IUPAC name is 1-(4-fluorophenoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol.
| Compound Name | 1-(4-fluorophenoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol |
|---|---|
| PubChem CID | 106292239 |
| Molecular Formula | C12H14F5NO2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-(4-fluorophenoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol |
| SMILES | OC(CNCC(F)(F)C(F)F)COc1ccc(F)cc1 |
| InChI | InChI=1S/C12H14F5NO2/c13-8-1-3-10(4-2-8)20-6-9(19)5-18-7-12(16,17)11(14)15/h1-4,9,11,18-19H,5-7H2 |
| InChIKey | OQAQFWQQBTTXQC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|