C13H27N3O4 — CID 83121091
3-[2-[[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]amino]ethyl]-1,1-dimethylurea (PubChem CID 83121091) has the molecular formula C13H27N3O4 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-[2-[[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83121091 |
| Molecular Formula | C13H27N3O4 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-[2-[[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCC(O)COCC1CCCO1 |
| InChI | InChI=1S/C13H27N3O4/c1-16(2)13(18)15-6-5-14-8-11(17)9-19-10-12-4-3-7-20-12/h11-12,14,17H,3-10H2,1-2H3,(H,15,18) |
| InChIKey | UHBMUTVYXYRUHM-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|