C12H23NO5 — CID 54937670
ethyl 2-[[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]amino]acetate (PubChem CID 54937670) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl 2-[[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]amino]acetate.
| Compound Name | ethyl 2-[[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]amino]acetate |
|---|---|
| PubChem CID | 54937670 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | ethyl 2-[[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]amino]acetate |
| SMILES | CCOC(=O)CNCC(O)COCC1CCCO1 |
| InChI | InChI=1S/C12H23NO5/c1-2-17-12(15)7-13-6-10(14)8-16-9-11-4-3-5-18-11/h10-11,13-14H,2-9H2,1H3 |
| InChIKey | JKJAFIZHNICKHU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |