C15H28N2O5 — CID 56777653
ethyl 4-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboxylate (PubChem CID 56777653) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl 4-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 56777653 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | ethyl 4-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(O)COCC2CCCO2)CC1 |
| InChI | InChI=1S/C15H28N2O5/c1-2-21-15(19)17-7-5-16(6-8-17)10-13(18)11-20-12-14-4-3-9-22-14/h13-14,18H,2-12H2,1H3 |
| InChIKey | ZBWAHTPERBCCLL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |