C17H29N3O3 — CID 95156770
(2R)-1-[[(2S)-oxolan-2-yl]methoxy]-3-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-ol (PubChem CID 95156770) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2R)-1-[[(2S)-oxolan-2-yl]methoxy]-3-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[[(2S)-oxolan-2-yl]methoxy]-3-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 95156770 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (2R)-1-[[(2S)-oxolan-2-yl]methoxy]-3-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-ol |
| SMILES | O[C@@H](COC[C@@H]1CCCO1)CN1CCC(Cn2cccn2)CC1 |
| InChI | InChI=1S/C17H29N3O3/c21-16(13-22-14-17-3-1-10-23-17)12-19-8-4-15(5-9-19)11-20-7-2-6-18-20/h2,6-7,15-17,21H,1,3-5,8-14H2/t16-,17+/m1/s1 |
| InChIKey | KODAXIRSLTZWAR-SJORKVTESA-N |
| XLogP | 1.15 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |