C18H27FN2O3 — CID 31263826
(2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[[(2R)-oxolan-2-yl]methoxy]propan-2-ol (PubChem CID 31263826) has the molecular formula C18H27FN2O3 and a molecular weight of 338.42 g/mol. Its IUPAC name is (2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[[(2R)-oxolan-2-yl]methoxy]propan-2-ol.
| Compound Name | (2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[[(2R)-oxolan-2-yl]methoxy]propan-2-ol |
|---|---|
| PubChem CID | 31263826 |
| Molecular Formula | C18H27FN2O3 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-[[(2R)-oxolan-2-yl]methoxy]propan-2-ol |
| SMILES | O[C@@H](COC[C@H]1CCCO1)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H27FN2O3/c19-15-3-5-16(6-4-15)21-9-7-20(8-10-21)12-17(22)13-23-14-18-2-1-11-24-18/h3-6,17-18,22H,1-2,7-14H2/t17-,18-/m1/s1 |
| InChIKey | VNJZFNLEGRFFSN-QZTJIDSGSA-N |
| XLogP | 1.50 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |