C16H23FN2O2 — CID 29132325
(2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-prop-2-enoxypropan-2-ol (PubChem CID 29132325) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is (2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 29132325 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2R)-1-[4-(4-fluorophenyl)piperazin-1-yl]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@H](O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN2O2/c1-2-11-21-13-16(20)12-18-7-9-19(10-8-18)15-5-3-14(17)4-6-15/h2-6,16,20H,1,7-13H2/t16-/m1/s1 |
| InChIKey | DGZWCHRQNXTPNV-MRXNPFEDSA-N |
| XLogP | 1.51 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|