C19H29NO4 — CID 78836914
4-[1-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperidin-4-yl]phenol (PubChem CID 78836914) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 4-[1-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperidin-4-yl]phenol.
| Compound Name | 4-[1-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 78836914 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 4-[1-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperidin-4-yl]phenol |
| SMILES | Oc1ccc(C2CCN(CC(O)COCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C19H29NO4/c21-17-5-3-15(4-6-17)16-7-9-20(10-8-16)12-18(22)13-23-14-19-2-1-11-24-19/h3-6,16,18-19,21-22H,1-2,7-14H2 |
| InChIKey | QLVSRDWRTFRNNB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |