C20H30N2O4 — CID 42928020
N-[1-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperidin-4-yl]benzamide (PubChem CID 42928020) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[1-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 42928020 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | N-[1-[2-hydroxy-3-(oxolan-2-ylmethoxy)propyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(CC(O)COCC2CCCO2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O4/c23-18(14-25-15-19-7-4-12-26-19)13-22-10-8-17(9-11-22)21-20(24)16-5-2-1-3-6-16/h1-3,5-6,17-19,23H,4,7-15H2,(H,21,24) |
| InChIKey | FNHZKUMCEBOYRR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |