C19H28N2O3 — CID 164638299
N-(1-benzylpiperidin-4-yl)-2-[[(2R)-oxolan-2-yl]methoxy]acetamide (PubChem CID 164638299) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-[[(2R)-oxolan-2-yl]methoxy]acetamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-[[(2R)-oxolan-2-yl]methoxy]acetamide |
|---|---|
| PubChem CID | 164638299 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-[[(2R)-oxolan-2-yl]methoxy]acetamide |
| SMILES | O=C(COC[C@H]1CCCO1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N2O3/c22-19(15-23-14-18-7-4-12-24-18)20-17-8-10-21(11-9-17)13-16-5-2-1-3-6-16/h1-3,5-6,17-18H,4,7-15H2,(H,20,22)/t18-/m1/s1 |
| InChIKey | BKBVUQPTORLRIC-GOSISDBHSA-N |
| XLogP | 1.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |