C9H22N2O2 — CID 62641406
(2S)-3-[2-[methyl(propan-2-yl)amino]ethylamino]propane-1,2-diol (PubChem CID 62641406) has the molecular formula C9H22N2O2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (2S)-3-[2-[methyl(propan-2-yl)amino]ethylamino]propane-1,2-diol.
| Compound Name | (2S)-3-[2-[methyl(propan-2-yl)amino]ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 62641406 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (2S)-3-[2-[methyl(propan-2-yl)amino]ethylamino]propane-1,2-diol |
| SMILES | CC(C)N(C)CCNC[C@H](O)CO |
| InChI | InChI=1S/C9H22N2O2/c1-8(2)11(3)5-4-10-6-9(13)7-12/h8-10,12-13H,4-7H2,1-3H3/t9-/m0/s1 |
| InChIKey | GDEPZRABALWRNT-VIFPVBQESA-N |
| XLogP | -0.73 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|