C8H19NO3 — CID 104760155
(2S)-3-(2-propan-2-yloxyethylamino)propane-1,2-diol (PubChem CID 104760155) has the molecular formula C8H19NO3 and a molecular weight of 177.24 g/mol. Its IUPAC name is (2S)-3-(2-propan-2-yloxyethylamino)propane-1,2-diol.
| Compound Name | (2S)-3-(2-propan-2-yloxyethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 104760155 |
| Molecular Formula | C8H19NO3 |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | (2S)-3-(2-propan-2-yloxyethylamino)propane-1,2-diol |
| SMILES | CC(C)OCCNC[C@H](O)CO |
| InChI | InChI=1S/C8H19NO3/c1-7(2)12-4-3-9-5-8(11)6-10/h7-11H,3-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | RHQPWCGSQIRZSO-QMMMGPOBSA-N |
| XLogP | -0.65 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|