C11H26N2O2 — CID 76891683
3-[2-[di(propan-2-yl)amino]ethylamino]propane-1,2-diol (PubChem CID 76891683) has the molecular formula C11H26N2O2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-[2-[di(propan-2-yl)amino]ethylamino]propane-1,2-diol.
| Compound Name | 3-[2-[di(propan-2-yl)amino]ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 76891683 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 3-[2-[di(propan-2-yl)amino]ethylamino]propane-1,2-diol |
| SMILES | CC(C)N(CCNCC(O)CO)C(C)C |
| InChI | InChI=1S/C11H26N2O2/c1-9(2)13(10(3)4)6-5-12-7-11(15)8-14/h9-12,14-15H,5-8H2,1-4H3 |
| InChIKey | NLJPYSDDNHRJMC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|