C5H12ClNO2 — CID 125498266
(2R)-3-(2-chloroethylamino)propane-1,2-diol (PubChem CID 125498266) has the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. Its IUPAC name is (2R)-3-(2-chloroethylamino)propane-1,2-diol.
| Compound Name | (2R)-3-(2-chloroethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 125498266 |
| Molecular Formula | C5H12ClNO2 |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | (2R)-3-(2-chloroethylamino)propane-1,2-diol |
| SMILES | OC[C@H](O)CNCCCl |
| InChI | InChI=1S/C5H12ClNO2/c6-1-2-7-3-5(9)4-8/h5,7-9H,1-4H2/t5-/m1/s1 |
| InChIKey | VVGWUAMYPPWSLS-RXMQYKEDSA-N |
| XLogP | -0.83 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|