About 5-cyanopentylcarbamic acid;hydrochloride
5-cyanopentylcarbamic acid;hydrochloride (PubChem CID 88781011) has the molecular formula C7H13ClN2O2
and a molecular weight of 192.65 g/mol. Its IUPAC name is 5-cyanopentylcarbamic acid;hydrochloride.
Molecular Properties
| Compound Name | 5-cyanopentylcarbamic acid;hydrochloride |
| PubChem CID | 88781011 |
| Molecular Formula | C7H13ClN2O2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 5-cyanopentylcarbamic acid;hydrochloride |
| SMILES | Cl.N#CCCCCCNC(=O)O |
| InChI | InChI=1S/C7H12N2O2.ClH/c8-5-3-1-2-4-6-9-7(10)11;/h9H,1-4,6H2,(H,10,11);1H |
| InChIKey | YDYKBAWDANYIFT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyanopentylcarbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyanopentylcarbamic acid;hydrochloride?
The IUPAC name of 5-cyanopentylcarbamic acid;hydrochloride (CID 88781011) is 5-cyanopentylcarbamic acid;hydrochloride.
What is the SMILES notation for 5-cyanopentylcarbamic acid;hydrochloride?
The canonical SMILES for 5-cyanopentylcarbamic acid;hydrochloride is Cl.N#CCCCCCNC(=O)O.
What is the InChIKey of 5-cyanopentylcarbamic acid;hydrochloride?
The InChIKey is YDYKBAWDANYIFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2.ClH/c8-5-3-1-2-4-6-9-7(10)11;/h9H,1-4,6H2,(H,10,11);1H.
What are the key properties of 5-cyanopentylcarbamic acid;hydrochloride?
5-cyanopentylcarbamic acid;hydrochloride has a molecular weight of 192.65 g/mol, XLogP of 1.76, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyanopentylcarbamic acid;hydrochloride is sourced from PubChem (CID 88781011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).