About oct-7-ynylcarbamic acid
oct-7-ynylcarbamic acid (PubChem CID 174966346) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is oct-7-ynylcarbamic acid.
Molecular Properties
| Compound Name | oct-7-ynylcarbamic acid |
| PubChem CID | 174966346 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | oct-7-ynylcarbamic acid |
| SMILES | C#CCCCCCCNC(=O)O |
| InChI | InChI=1S/C9H15NO2/c1-2-3-4-5-6-7-8-10-9(11)12/h1,10H,3-8H2,(H,11,12) |
| InChIKey | FWEDDPFRBQGKGQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-7-ynylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-7-ynylcarbamic acid?
The IUPAC name of oct-7-ynylcarbamic acid (CID 174966346) is oct-7-ynylcarbamic acid.
What is the SMILES notation for oct-7-ynylcarbamic acid?
The canonical SMILES for oct-7-ynylcarbamic acid is C#CCCCCCCNC(=O)O.
What is the InChIKey of oct-7-ynylcarbamic acid?
The InChIKey is FWEDDPFRBQGKGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-2-3-4-5-6-7-8-10-9(11)12/h1,10H,3-8H2,(H,11,12).
What are the key properties of oct-7-ynylcarbamic acid?
oct-7-ynylcarbamic acid has a molecular weight of 169.22 g/mol, XLogP of 1.84, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oct-7-ynylcarbamic acid is sourced from PubChem (CID 174966346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).