About phenyl N-hex-5-ynylcarbamate
phenyl N-hex-5-ynylcarbamate (PubChem CID 103758023) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is phenyl N-hex-5-ynylcarbamate.
Molecular Properties
| Compound Name | phenyl N-hex-5-ynylcarbamate |
| PubChem CID | 103758023 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | phenyl N-hex-5-ynylcarbamate |
| SMILES | C#CCCCCNC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c1-2-3-4-8-11-14-13(15)16-12-9-6-5-7-10-12/h1,5-7,9-10H,3-4,8,11H2,(H,14,15) |
| InChIKey | BRYCADPSKOFQRI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-hex-5-ynylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-hex-5-ynylcarbamate?
The IUPAC name of phenyl N-hex-5-ynylcarbamate (CID 103758023) is phenyl N-hex-5-ynylcarbamate.
What is the SMILES notation for phenyl N-hex-5-ynylcarbamate?
The canonical SMILES for phenyl N-hex-5-ynylcarbamate is C#CCCCCNC(=O)Oc1ccccc1.
What is the InChIKey of phenyl N-hex-5-ynylcarbamate?
The InChIKey is BRYCADPSKOFQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-2-3-4-8-11-14-13(15)16-12-9-6-5-7-10-12/h1,5-7,9-10H,3-4,8,11H2,(H,14,15).
What are the key properties of phenyl N-hex-5-ynylcarbamate?
phenyl N-hex-5-ynylcarbamate has a molecular weight of 217.27 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-hex-5-ynylcarbamate is sourced from PubChem (CID 103758023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).