C14H20N2O5 — CID 101097909
3-(phenoxycarbonylamino)propyl N-(3-hydroxypropyl)carbamate (PubChem CID 101097909) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-(phenoxycarbonylamino)propyl N-(3-hydroxypropyl)carbamate.
| Compound Name | 3-(phenoxycarbonylamino)propyl N-(3-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 101097909 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3-(phenoxycarbonylamino)propyl N-(3-hydroxypropyl)carbamate |
| SMILES | O=C(NCCCO)OCCCNC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H20N2O5/c17-10-4-8-15-13(18)20-11-5-9-16-14(19)21-12-6-2-1-3-7-12/h1-3,6-7,17H,4-5,8-11H2,(H,15,18)(H,16,19) |
| InChIKey | MXZORCBCTRTNKD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|