About 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate
4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate (PubChem CID 175946939) has the molecular formula C14H28N2O6
and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate.
Molecular Properties
| Compound Name | 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate |
| PubChem CID | 175946939 |
| Molecular Formula | C14H28N2O6 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate |
| SMILES | O=C(NCCCCNC(=O)OCCCCO)OCCCCO |
| InChI | InChI=1S/C14H28N2O6/c17-9-3-5-11-21-13(19)15-7-1-2-8-16-14(20)22-12-6-4-10-18/h17-18H,1-12H2,(H,15,19)(H,16,20) |
| InChIKey | OWGWGNGNMAHADR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate?
The IUPAC name of 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate (CID 175946939) is 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate.
What is the SMILES notation for 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate?
The canonical SMILES for 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate is O=C(NCCCCNC(=O)OCCCCO)OCCCCO.
What is the InChIKey of 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate?
The InChIKey is OWGWGNGNMAHADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O6/c17-9-3-5-11-21-13(19)15-7-1-2-8-16-14(20)22-12-6-4-10-18/h17-18H,1-12H2,(H,15,19)(H,16,20).
What are the key properties of 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate?
4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate has a molecular weight of 320.39 g/mol, XLogP of 0.76, 13 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl N-[4-(4-hydroxybutoxycarbonylamino)butyl]carbamate is sourced from PubChem (CID 175946939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).