C28H48N2O13 — CID 101096938
4-[4-[6-[4-[4-(4-hydroxybutoxy)-4-oxobutanoyl]oxybutoxycarbonylamino]hexylcarbamoyloxy]butoxy]-4-oxobutanoic acid (PubChem CID 101096938) has the molecular formula C28H48N2O13 and a molecular weight of 620.69 g/mol. Its IUPAC name is 4-[4-[6-[4-[4-(4-hydroxybutoxy)-4-oxobutanoyl]oxybutoxycarbonylamino]hexylcarbamoyloxy]butoxy]-4-oxobutanoic acid.
| Compound Name | 4-[4-[6-[4-[4-(4-hydroxybutoxy)-4-oxobutanoyl]oxybutoxycarbonylamino]hexylcarbamoyloxy]butoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 101096938 |
| Molecular Formula | C28H48N2O13 |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | 4-[4-[6-[4-[4-(4-hydroxybutoxy)-4-oxobutanoyl]oxybutoxycarbonylamino]hexylcarbamoyloxy]butoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OCCCCOC(=O)NCCCCCCNC(=O)OCCCCOC(=O)CCC(=O)OCCCCO |
| InChI | InChI=1S/C28H48N2O13/c31-17-5-6-18-39-25(35)13-14-26(36)41-20-8-10-22-43-28(38)30-16-4-2-1-3-15-29-27(37)42-21-9-7-19-40-24(34)12-11-23(32)33/h31H,1-22H2,(H,29,37)(H,30,38)(H,32,33) |
| InChIKey | WGTWXEHHFPKVHZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 213.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|