About 5-hydroxypentyl N-methylcarbamate
5-hydroxypentyl N-methylcarbamate (PubChem CID 138694704) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is 5-hydroxypentyl N-methylcarbamate.
Molecular Properties
| Compound Name | 5-hydroxypentyl N-methylcarbamate |
| PubChem CID | 138694704 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 5-hydroxypentyl N-methylcarbamate |
| SMILES | CNC(=O)OCCCCCO |
| InChI | InChI=1S/C7H15NO3/c1-8-7(10)11-6-4-2-3-5-9/h9H,2-6H2,1H3,(H,8,10) |
| InChIKey | JVQOPEBJJDPMOW-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxypentyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxypentyl N-methylcarbamate?
The IUPAC name of 5-hydroxypentyl N-methylcarbamate (CID 138694704) is 5-hydroxypentyl N-methylcarbamate.
What is the SMILES notation for 5-hydroxypentyl N-methylcarbamate?
The canonical SMILES for 5-hydroxypentyl N-methylcarbamate is CNC(=O)OCCCCCO.
What is the InChIKey of 5-hydroxypentyl N-methylcarbamate?
The InChIKey is JVQOPEBJJDPMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO3/c1-8-7(10)11-6-4-2-3-5-9/h9H,2-6H2,1H3,(H,8,10).
What are the key properties of 5-hydroxypentyl N-methylcarbamate?
5-hydroxypentyl N-methylcarbamate has a molecular weight of 161.20 g/mol, XLogP of 0.50, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxypentyl N-methylcarbamate is sourced from PubChem (CID 138694704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).