C13H17Cl2N3OS — CID 70165680
3,4-dichloro-N-(8-cyanooctyl)-1,2-thiazole-5-carboxamide (PubChem CID 70165680) has the molecular formula C13H17Cl2N3OS and a molecular weight of 334.27 g/mol. Its IUPAC name is 3,4-dichloro-N-(8-cyanooctyl)-1,2-thiazole-5-carboxamide.
| Compound Name | 3,4-dichloro-N-(8-cyanooctyl)-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 70165680 |
| Molecular Formula | C13H17Cl2N3OS |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 3,4-dichloro-N-(8-cyanooctyl)-1,2-thiazole-5-carboxamide |
| SMILES | N#CCCCCCCCCNC(=O)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C13H17Cl2N3OS/c14-10-11(20-18-12(10)15)13(19)17-9-7-5-3-1-2-4-6-8-16/h1-7,9H2,(H,17,19) |
| InChIKey | CXLZNNYVFWSDFY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|