C8H18N2O3S — CID 61037616
N,N-dimethyl-2-(3-methylsulfonylpropylamino)acetamide (PubChem CID 61037616) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-methylsulfonylpropylamino)acetamide.
| Compound Name | N,N-dimethyl-2-(3-methylsulfonylpropylamino)acetamide |
|---|---|
| PubChem CID | 61037616 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N,N-dimethyl-2-(3-methylsulfonylpropylamino)acetamide |
| SMILES | CN(C)C(=O)CNCCCS(C)(=O)=O |
| InChI | InChI=1S/C8H18N2O3S/c1-10(2)8(11)7-9-5-4-6-14(3,12)13/h9H,4-7H2,1-3H3 |
| InChIKey | FYEUUULPRYBOAL-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|