C8H20N2O — CID 162757499
ethane;2-(ethylamino)-N,N-dimethylacetamide (PubChem CID 162757499) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is ethane;2-(ethylamino)-N,N-dimethylacetamide.
| Compound Name | ethane;2-(ethylamino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 162757499 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | ethane;2-(ethylamino)-N,N-dimethylacetamide |
| SMILES | CC.CCNCC(=O)N(C)C |
| InChI | InChI=1S/C6H14N2O.C2H6/c1-4-7-5-6(9)8(2)3;1-2/h7H,4-5H2,1-3H3;1-2H3 |
| InChIKey | SHZLSYPQTHKJFX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |