C10H24N2O — CID 163258584
ethane;N-[2-[methyl(propan-2-yl)amino]ethyl]acetamide (PubChem CID 163258584) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is ethane;N-[2-[methyl(propan-2-yl)amino]ethyl]acetamide.
| Compound Name | ethane;N-[2-[methyl(propan-2-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 163258584 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | ethane;N-[2-[methyl(propan-2-yl)amino]ethyl]acetamide |
| SMILES | CC.CC(=O)NCCN(C)C(C)C |
| InChI | InChI=1S/C8H18N2O.C2H6/c1-7(2)10(4)6-5-9-8(3)11;1-2/h7H,5-6H2,1-4H3,(H,9,11);1-2H3 |
| InChIKey | LIRHHFJNYMJQIA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |