N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen

C8H22N2O — CID 156646595

IUPACN-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen
SMILESCC.CC(=O)NCCN(C)C.[H][H]
InChIInChI=1S/C6H14N2O.C2H6.H2/c1-6(9)7-4-5-8(2)3;1-2;/h4-5H2,1-3H3,(H,7,9);1-2H3;1H
InChIKeyOYSQYDYZYXVUHE-UHFFFAOYSA-N
MW162.28 g/mol
LogP0.96
Rot. Bonds3

About N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen

N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen (PubChem CID 156646595) has the molecular formula C8H22N2O and a molecular weight of 162.28 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen.

Molecular Properties

Compound NameN-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen
PubChem CID156646595
Molecular FormulaC8H22N2O
Molecular Weight162.28 g/mol
Exact Mass162.17
IUPAC NameN-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen
SMILESCC.CC(=O)NCCN(C)C.[H][H]
InChIInChI=1S/C6H14N2O.C2H6.H2/c1-6(9)7-4-5-8(2)3;1-2;/h4-5H2,1-3H3,(H,7,9);1-2H3;1H
InChIKeyOYSQYDYZYXVUHE-UHFFFAOYSA-N
XLogP0.96
TPSA32.34 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.28
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen?
The IUPAC name of N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen (CID 156646595) is N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen?
The canonical SMILES for N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen is CC.CC(=O)NCCN(C)C.[H][H].
What is the InChIKey of N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen?
The InChIKey is OYSQYDYZYXVUHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.C2H6.H2/c1-6(9)7-4-5-8(2)3;1-2;/h4-5H2,1-3H3,(H,7,9);1-2H3;1H.
What are the key properties of N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen?
N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen has a molecular weight of 162.28 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]acetamide;ethane;molecular hydrogen is sourced from PubChem (CID 156646595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).