C10H22N2O3S — CID 81189441
2-(2-aminopropylsulfonyl)-N-pentan-3-ylacetamide (PubChem CID 81189441) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-(2-aminopropylsulfonyl)-N-pentan-3-ylacetamide.
| Compound Name | 2-(2-aminopropylsulfonyl)-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 81189441 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-(2-aminopropylsulfonyl)-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CS(=O)(=O)CC(C)N |
| InChI | InChI=1S/C10H22N2O3S/c1-4-9(5-2)12-10(13)7-16(14,15)6-8(3)11/h8-9H,4-7,11H2,1-3H3,(H,12,13) |
| InChIKey | ZANBPJRKYMAMSC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |