C9H17N3O2S — CID 81194531
2-(4-aminobutan-2-ylsulfinyl)-N-(2-cyanoethyl)acetamide (PubChem CID 81194531) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-(4-aminobutan-2-ylsulfinyl)-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-(4-aminobutan-2-ylsulfinyl)-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 81194531 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-(4-aminobutan-2-ylsulfinyl)-N-(2-cyanoethyl)acetamide |
| SMILES | CC(CCN)S(=O)CC(=O)NCCC#N |
| InChI | InChI=1S/C9H17N3O2S/c1-8(3-5-11)15(14)7-9(13)12-6-2-4-10/h8H,2-3,5-7,11H2,1H3,(H,12,13) |
| InChIKey | VWYWWSGYCLAIEL-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|